C31H29Cl3N4O4 — CID 67362142
1-[4-chloro-2-[(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]phenoxy]-N-ethylpyrrolidine-3-carboxamide (PubChem CID 67362142) has the molecular formula C31H29Cl3N4O4 and a molecular weight of 627.96 g/mol. Its IUPAC name is 1-[4-chloro-2-[(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]phenoxy]-N-ethylpyrrolidine-3-carboxamide.
| Compound Name | 1-[4-chloro-2-[(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]phenoxy]-N-ethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 67362142 |
| Molecular Formula | C31H29Cl3N4O4 |
| Molecular Weight | 627.96 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | 1-[4-chloro-2-[(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]phenoxy]-N-ethylpyrrolidine-3-carboxamide |
| SMILES | CCNC(=O)C1CCN(Oc2ccc(Cl)cc2[C@H]2NC(=O)C[C@@H](c3cccc(Cl)c3)[C@]23C(=O)Nc2cc(Cl)ccc23)C1 |
| InChI | InChI=1S/C31H29Cl3N4O4/c1-2-35-29(40)18-10-11-38(16-18)42-26-9-7-20(33)13-22(26)28-31(23-8-6-21(34)14-25(23)36-30(31)41)24(15-27(39)37-28)17-4-3-5-19(32)12-17/h3-9,12-14,18,24,28H,2,10-11,15-16H2,1H3,(H,35,40)(H,36,41)(H,37,39)/t18?,24-,28+,31-/m0/s1 |
| InChIKey | HCTTXOUBTZUZLK-LMVTYPLYSA-N |
| XLogP | 5.63 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.96 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |