About 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid
5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid (PubChem CID 67362267) has the molecular formula C8H8N4O2
and a molecular weight of 192.18 g/mol. Its IUPAC name is 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid.
Molecular Properties
| Compound Name | 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid |
| PubChem CID | 67362267 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid |
| SMILES | O=C(O)NCc1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C8H8N4O2/c13-8(14)11-4-5-3-10-7-6(12-5)1-2-9-7/h1-3,11H,4H2,(H,9,10)(H,13,14) |
| InChIKey | HQNBKQFGLYINNW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid?
The IUPAC name of 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid (CID 67362267) is 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid.
What is the SMILES notation for 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid?
The canonical SMILES for 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid is O=C(O)NCc1cnc2[nH]ccc2n1.
What is the InChIKey of 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid?
The InChIKey is HQNBKQFGLYINNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2/c13-8(14)11-4-5-3-10-7-6(12-5)1-2-9-7/h1-3,11H,4H2,(H,9,10)(H,13,14).
What are the key properties of 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid?
5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid has a molecular weight of 192.18 g/mol, XLogP of 0.73, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrrolo[2,3-b]pyrazin-2-ylmethylcarbamic acid is sourced from PubChem (CID 67362267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).