C29H42N4O5Si — CID 67362308
tert-butyl N-[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamate (PubChem CID 67362308) has the molecular formula C29H42N4O5Si and a molecular weight of 554.76 g/mol. Its IUPAC name is tert-butyl N-[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamate |
|---|---|
| PubChem CID | 67362308 |
| Molecular Formula | C29H42N4O5Si |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | tert-butyl N-[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamate |
| SMILES | CCc1c(-c2ccc(C3(C)OCCO3)cc2)n(COCC[Si](C)(C)C)c2ncc(NC(=O)OC(C)(C)C)nc12 |
| InChI | InChI=1S/C29H42N4O5Si/c1-9-22-24-26(30-18-23(31-24)32-27(34)38-28(2,3)4)33(19-35-16-17-39(6,7)8)25(22)20-10-12-21(13-11-20)29(5)36-14-15-37-29/h10-13,18H,9,14-17,19H2,1-8H3,(H,31,32,34) |
| InChIKey | JMIVGVNWQGRNJB-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|