C24H20N6O2S — CID 67362340
3-methyl-10-(4-methylphenyl)sulfonyl-11-(1-methylpyrrolo[3,2-c]pyridin-3-yl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 67362340) has the molecular formula C24H20N6O2S and a molecular weight of 456.53 g/mol. Its IUPAC name is 3-methyl-10-(4-methylphenyl)sulfonyl-11-(1-methylpyrrolo[3,2-c]pyridin-3-yl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-methyl-10-(4-methylphenyl)sulfonyl-11-(1-methylpyrrolo[3,2-c]pyridin-3-yl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 67362340 |
| Molecular Formula | C24H20N6O2S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 3-methyl-10-(4-methylphenyl)sulfonyl-11-(1-methylpyrrolo[3,2-c]pyridin-3-yl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | Cc1ccc(S(=O)(=O)n2c(-c3cn(C)c4ccncc34)cc3c4c(cnc32)cnn4C)cc1 |
| InChI | InChI=1S/C24H20N6O2S/c1-15-4-6-17(7-5-15)33(31,32)30-22(20-14-28(2)21-8-9-25-13-19(20)21)10-18-23-16(11-26-24(18)30)12-27-29(23)3/h4-14H,1-3H3 |
| InChIKey | CBQZHWGJWFKSHD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 87.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |