C25H24N4O3S — CID 67362516
2-[4-[12-methyl-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol (PubChem CID 67362516) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 2-[4-[12-methyl-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[12-methyl-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 67362516 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[4-[12-methyl-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2c(-c4ccc(C(C)(C)O)cc4)nc(C)n23)cc1 |
| InChI | InChI=1S/C25H24N4O3S/c1-16-5-11-20(12-6-16)33(31,32)28-14-13-21-24(28)26-15-22-23(27-17(2)29(21)22)18-7-9-19(10-8-18)25(3,4)30/h5-15,30H,1-4H3 |
| InChIKey | CEDYURFIJTZLJB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |