C25H21F3N4O3S — CID 67362600
2-[4-[5-(4-methylphenyl)sulfonyl-12-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol (PubChem CID 67362600) has the molecular formula C25H21F3N4O3S and a molecular weight of 514.53 g/mol. Its IUPAC name is 2-[4-[5-(4-methylphenyl)sulfonyl-12-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[5-(4-methylphenyl)sulfonyl-12-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 67362600 |
| Molecular Formula | C25H21F3N4O3S |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 2-[4-[5-(4-methylphenyl)sulfonyl-12-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2c(-c4ccc(C(C)(C)O)cc4)nc(C(F)(F)F)n23)cc1 |
| InChI | InChI=1S/C25H21F3N4O3S/c1-15-4-10-18(11-5-15)36(34,35)31-13-12-19-22(31)29-14-20-21(30-23(32(19)20)25(26,27)28)16-6-8-17(9-7-16)24(2,3)33/h4-14,33H,1-3H3 |
| InChIKey | HQBYAZXFNFPPPS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |