C21H22F3N3O2 — CID 67362626
3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[1-methyl-5-[3-(trifluoromethoxy)phenyl]pyrazol-4-yl]methanone (PubChem CID 67362626) has the molecular formula C21H22F3N3O2 and a molecular weight of 405.42 g/mol. Its IUPAC name is 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[1-methyl-5-[3-(trifluoromethoxy)phenyl]pyrazol-4-yl]methanone.
| Compound Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[1-methyl-5-[3-(trifluoromethoxy)phenyl]pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 67362626 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[1-methyl-5-[3-(trifluoromethoxy)phenyl]pyrazol-4-yl]methanone |
| SMILES | Cn1ncc(C(=O)N2CCCC3CCCC=C32)c1-c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3N3O2/c1-26-19(15-7-4-9-16(12-15)29-21(22,23)24)17(13-25-26)20(28)27-11-5-8-14-6-2-3-10-18(14)27/h4,7,9-10,12-14H,2-3,5-6,8,11H2,1H3 |
| InChIKey | DUDNYTCMTOYHOC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |