C15H10Cl2N4O — CID 67363152
6-(2,4-dichlorophenoxy)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 67363152) has the molecular formula C15H10Cl2N4O and a molecular weight of 333.18 g/mol. Its IUPAC name is 6-(2,4-dichlorophenoxy)-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-(2,4-dichlorophenoxy)-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 67363152 |
| Molecular Formula | C15H10Cl2N4O |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 6-(2,4-dichlorophenoxy)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | Nc1nnc(Oc2ccc(Cl)cc2Cl)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H10Cl2N4O/c16-10-6-7-12(11(17)8-10)22-14-13(19-15(18)21-20-14)9-4-2-1-3-5-9/h1-8H,(H2,18,19,21) |
| InChIKey | YDFLBLIVVPIOIG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |