C15H24N2O — CID 67363200
3,3,4-trimethyl-1-[(pyridin-2-ylamino)methyl]cyclohexan-1-ol (PubChem CID 67363200) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 3,3,4-trimethyl-1-[(pyridin-2-ylamino)methyl]cyclohexan-1-ol.
| Compound Name | 3,3,4-trimethyl-1-[(pyridin-2-ylamino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 67363200 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 3,3,4-trimethyl-1-[(pyridin-2-ylamino)methyl]cyclohexan-1-ol |
| SMILES | CC1CCC(O)(CNc2ccccn2)CC1(C)C |
| InChI | InChI=1S/C15H24N2O/c1-12-7-8-15(18,10-14(12,2)3)11-17-13-6-4-5-9-16-13/h4-6,9,12,18H,7-8,10-11H2,1-3H3,(H,16,17) |
| InChIKey | BTTGDFIZVBCKLI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |