C31H29N5O5S — CID 67363479
3-[12-cyclohexyl-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]-5-methoxyindole-1-carboxylic acid (PubChem CID 67363479) has the molecular formula C31H29N5O5S and a molecular weight of 583.67 g/mol. Its IUPAC name is 3-[12-cyclohexyl-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]-5-methoxyindole-1-carboxylic acid.
| Compound Name | 3-[12-cyclohexyl-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]-5-methoxyindole-1-carboxylic acid |
|---|---|
| PubChem CID | 67363479 |
| Molecular Formula | C31H29N5O5S |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 3-[12-cyclohexyl-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]-5-methoxyindole-1-carboxylic acid |
| SMILES | COc1ccc2c(c1)c(-c1nc(C3CCCCC3)n3c1cnc1c3ccn1S(=O)(=O)c1ccc(C)cc1)cn2C(=O)O |
| InChI | InChI=1S/C31H29N5O5S/c1-19-8-11-22(12-9-19)42(39,40)35-15-14-26-30(35)32-17-27-28(33-29(36(26)27)20-6-4-3-5-7-20)24-18-34(31(37)38)25-13-10-21(41-2)16-23(24)25/h8-18,20H,3-7H2,1-2H3,(H,37,38) |
| InChIKey | PISBDCBFFASRPG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |