C10H14F3N — CID 67363537
3,3,4,4-tetramethyl-6-(trifluoromethyl)pyridine (PubChem CID 67363537) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is 3,3,4,4-tetramethyl-6-(trifluoromethyl)pyridine.
| Compound Name | 3,3,4,4-tetramethyl-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 67363537 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3,3,4,4-tetramethyl-6-(trifluoromethyl)pyridine |
| SMILES | CC1(C)C=NC(C(F)(F)F)=CC1(C)C |
| InChI | InChI=1S/C10H14F3N/c1-8(2)5-7(10(11,12)13)14-6-9(8,3)4/h5-6H,1-4H3 |
| InChIKey | IVPIDXBODVWEEL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |