C21H26ClN3 — CID 67363572
3,5-dimethylpyridine;4-(3,5-dimethylpyridin-1-ium-1-yl)-3,5-dimethylpyridine;chloride (PubChem CID 67363572) has the molecular formula C21H26ClN3 and a molecular weight of 355.91 g/mol. Its IUPAC name is 3,5-dimethylpyridine;4-(3,5-dimethylpyridin-1-ium-1-yl)-3,5-dimethylpyridine;chloride.
| Compound Name | 3,5-dimethylpyridine;4-(3,5-dimethylpyridin-1-ium-1-yl)-3,5-dimethylpyridine;chloride |
|---|---|
| PubChem CID | 67363572 |
| Molecular Formula | C21H26ClN3 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 3,5-dimethylpyridine;4-(3,5-dimethylpyridin-1-ium-1-yl)-3,5-dimethylpyridine;chloride |
| SMILES | Cc1cc(C)c[n+](-c2c(C)cncc2C)c1.Cc1cncc(C)c1.[Cl-] |
| InChI | InChI=1S/C14H17N2.C7H9N.ClH/c1-10-5-11(2)9-16(8-10)14-12(3)6-15-7-13(14)4;1-6-3-7(2)5-8-4-6;/h5-9H,1-4H3;3-5H,1-2H3;1H/q+1;;/p-1 |
| InChIKey | GRXMVNSJIGGJCF-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|