C18H18F2O2 — CID 67364808
(1S,3E,4R)-3-[2-(2,5-difluorophenyl)-2-oxoethylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 67364808) has the molecular formula C18H18F2O2 and a molecular weight of 304.34 g/mol. Its IUPAC name is (1S,3E,4R)-3-[2-(2,5-difluorophenyl)-2-oxoethylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3E,4R)-3-[2-(2,5-difluorophenyl)-2-oxoethylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 67364808 |
| Molecular Formula | C18H18F2O2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (1S,3E,4R)-3-[2-(2,5-difluorophenyl)-2-oxoethylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)/C2=C/C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H18F2O2/c1-17(2)13-6-7-18(17,3)16(22)11(13)9-15(21)12-8-10(19)4-5-14(12)20/h4-5,8-9,13H,6-7H2,1-3H3/b11-9+/t13-,18+/m0/s1 |
| InChIKey | AUQZDDUBWXANMS-VIKMJRFMSA-N |
| XLogP | 4.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|