C14H14Cl2FN3O4 — CID 67364882
[(1R,2S)-1-(6-cyano-3-pyridinyl)-2-[(2,2-dichloroacetyl)amino]-3-fluoropropyl] ethyl carbonate (PubChem CID 67364882) has the molecular formula C14H14Cl2FN3O4 and a molecular weight of 378.19 g/mol. Its IUPAC name is [(1R,2S)-1-(6-cyano-3-pyridinyl)-2-[(2,2-dichloroacetyl)amino]-3-fluoropropyl] ethyl carbonate.
| Compound Name | [(1R,2S)-1-(6-cyano-3-pyridinyl)-2-[(2,2-dichloroacetyl)amino]-3-fluoropropyl] ethyl carbonate |
|---|---|
| PubChem CID | 67364882 |
| Molecular Formula | C14H14Cl2FN3O4 |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | [(1R,2S)-1-(6-cyano-3-pyridinyl)-2-[(2,2-dichloroacetyl)amino]-3-fluoropropyl] ethyl carbonate |
| SMILES | CCOC(=O)O[C@H](c1ccc(C#N)nc1)[C@@H](CF)NC(=O)C(Cl)Cl |
| InChI | InChI=1S/C14H14Cl2FN3O4/c1-2-23-14(22)24-11(8-3-4-9(6-18)19-7-8)10(5-17)20-13(21)12(15)16/h3-4,7,10-12H,2,5H2,1H3,(H,20,21)/t10-,11-/m1/s1 |
| InChIKey | KXNMUIAYCRGXAL-GHMZBOCLSA-N |
| XLogP | 2.43 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|