C21H26N2O5 — CID 67365069
methyl 6-[3-(3,5-dimethylanilino)-4-nitrophenoxy]hexanoate (PubChem CID 67365069) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is methyl 6-[3-(3,5-dimethylanilino)-4-nitrophenoxy]hexanoate.
| Compound Name | methyl 6-[3-(3,5-dimethylanilino)-4-nitrophenoxy]hexanoate |
|---|---|
| PubChem CID | 67365069 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | methyl 6-[3-(3,5-dimethylanilino)-4-nitrophenoxy]hexanoate |
| SMILES | COC(=O)CCCCCOc1ccc([N+](=O)[O-])c(Nc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C21H26N2O5/c1-15-11-16(2)13-17(12-15)22-19-14-18(8-9-20(19)23(25)26)28-10-6-4-5-7-21(24)27-3/h8-9,11-14,22H,4-7,10H2,1-3H3 |
| InChIKey | MXXCDHSUKXXJJE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|