C19H21ClO2 — CID 67365765
2-[2-[1-(4-chlorophenyl)cyclopropyl]-2-oxoethyl]cyclooct-2-en-1-one (PubChem CID 67365765) has the molecular formula C19H21ClO2 and a molecular weight of 316.83 g/mol. Its IUPAC name is 2-[2-[1-(4-chlorophenyl)cyclopropyl]-2-oxoethyl]cyclooct-2-en-1-one.
| Compound Name | 2-[2-[1-(4-chlorophenyl)cyclopropyl]-2-oxoethyl]cyclooct-2-en-1-one |
|---|---|
| PubChem CID | 67365765 |
| Molecular Formula | C19H21ClO2 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[2-[1-(4-chlorophenyl)cyclopropyl]-2-oxoethyl]cyclooct-2-en-1-one |
| SMILES | O=C1CCCCCC=C1CC(=O)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H21ClO2/c20-16-9-7-15(8-10-16)19(11-12-19)18(22)13-14-5-3-1-2-4-6-17(14)21/h5,7-10H,1-4,6,11-13H2 |
| InChIKey | MQBPATIHNJLKOG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |