About 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid
2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid (PubChem CID 67365914) has the molecular formula C17H21NO3
and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid |
| PubChem CID | 67365914 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(OC1(c2ccc(C#N)cc2)CCC1)C(=O)O |
| InChI | InChI=1S/C17H21NO3/c1-16(2,3)14(15(19)20)21-17(9-4-10-17)13-7-5-12(11-18)6-8-13/h5-8,14H,4,9-10H2,1-3H3,(H,19,20) |
| InChIKey | GKDYHYZMKMATHT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid?
The IUPAC name of 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid (CID 67365914) is 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid.
What is the SMILES notation for 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid?
The canonical SMILES for 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid is CC(C)(C)C(OC1(c2ccc(C#N)cc2)CCC1)C(=O)O.
What is the InChIKey of 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid?
The InChIKey is GKDYHYZMKMATHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO3/c1-16(2,3)14(15(19)20)21-17(9-4-10-17)13-7-5-12(11-18)6-8-13/h5-8,14H,4,9-10H2,1-3H3,(H,19,20).
What are the key properties of 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid?
2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid has a molecular weight of 287.36 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-cyanophenyl)cyclobutyl]oxy-3,3-dimethylbutanoic acid is sourced from PubChem (CID 67365914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).