About 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate
2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 6736593) has the molecular formula C13H14F5N3O2
and a molecular weight of 339.26 g/mol. Its IUPAC name is 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate |
| PubChem CID | 6736593 |
| Molecular Formula | C13H14F5N3O2 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | O=C(OCC(F)F)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C13H14F5N3O2/c14-10(15)8-23-12(22)21-5-3-20(4-6-21)11-2-1-9(7-19-11)13(16,17)18/h1-2,7,10H,3-6,8H2 |
| InChIKey | MQBGKUOWHXMHEH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate?
The IUPAC name of 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate (CID 6736593) is 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate.
What is the SMILES notation for 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate?
The canonical SMILES for 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate is O=C(OCC(F)F)N1CCN(c2ccc(C(F)(F)F)cn2)CC1.
What is the InChIKey of 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate?
The InChIKey is MQBGKUOWHXMHEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F5N3O2/c14-10(15)8-23-12(22)21-5-3-20(4-6-21)11-2-1-9(7-19-11)13(16,17)18/h1-2,7,10H,3-6,8H2.
What are the key properties of 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate?
2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate has a molecular weight of 339.26 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate is sourced from PubChem (CID 6736593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).