About CID 67366174
CID 67366174 (PubChem CID 67366174) has the molecular formula C22H16BN2O2
and a molecular weight of 351.19 g/mol.
Molecular Properties
| Compound Name | CID 67366174 |
| PubChem CID | 67366174 |
| Molecular Formula | C22H16BN2O2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | — |
| SMILES | [B](Oc1cncc(-c2ccccc2)c1)Oc1cncc(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H16BN2O2/c1-3-7-17(8-4-1)19-11-21(15-24-13-19)26-23-27-22-12-20(14-25-16-22)18-9-5-2-6-10-18/h1-16H |
| InChIKey | UQHSNOWQXSNSNS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67366174 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67366174?
The IUPAC name of CID 67366174 (CID 67366174) is not available.
What is the SMILES notation for CID 67366174?
The canonical SMILES for CID 67366174 is [B](Oc1cncc(-c2ccccc2)c1)Oc1cncc(-c2ccccc2)c1.
What is the InChIKey of CID 67366174?
The InChIKey is UQHSNOWQXSNSNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16BN2O2/c1-3-7-17(8-4-1)19-11-21(15-24-13-19)26-23-27-22-12-20(14-25-16-22)18-9-5-2-6-10-18/h1-16H.
What are the key properties of CID 67366174?
CID 67366174 has a molecular weight of 351.19 g/mol, XLogP of 4.80, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67366174 is sourced from PubChem (CID 67366174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).