C15H12N4O3 — CID 67367247
1-(2,4-dihydroxyphenyl)-2-[4-(2H-tetrazol-5-yl)phenyl]ethanone (PubChem CID 67367247) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)-2-[4-(2H-tetrazol-5-yl)phenyl]ethanone.
| Compound Name | 1-(2,4-dihydroxyphenyl)-2-[4-(2H-tetrazol-5-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 67367247 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-2-[4-(2H-tetrazol-5-yl)phenyl]ethanone |
| SMILES | O=C(Cc1ccc(-c2nn[nH]n2)cc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C15H12N4O3/c20-11-5-6-12(14(22)8-11)13(21)7-9-1-3-10(4-2-9)15-16-18-19-17-15/h1-6,8,20,22H,7H2,(H,16,17,18,19) |
| InChIKey | GGUYGMKQUJMOES-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |