About N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide
N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide (PubChem CID 67367298) has the molecular formula C18H16F2N4O
and a molecular weight of 342.35 g/mol. Its IUPAC name is N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide |
| PubChem CID | 67367298 |
| Molecular Formula | C18H16F2N4O |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1n[nH]c2c(F)c(F)c(-c3ccccc3)cc12)N1CCCC1 |
| InChI | InChI=1S/C18H16F2N4O/c19-14-12(11-6-2-1-3-7-11)10-13-16(15(14)20)22-23-17(13)21-18(25)24-8-4-5-9-24/h1-3,6-7,10H,4-5,8-9H2,(H2,21,22,23,25) |
| InChIKey | MVVQBLQFJPBWQK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide?
The IUPAC name of N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide (CID 67367298) is N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide.
What is the SMILES notation for N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide?
The canonical SMILES for N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide is O=C(Nc1n[nH]c2c(F)c(F)c(-c3ccccc3)cc12)N1CCCC1.
What is the InChIKey of N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide?
The InChIKey is MVVQBLQFJPBWQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2N4O/c19-14-12(11-6-2-1-3-7-11)10-13-16(15(14)20)22-23-17(13)21-18(25)24-8-4-5-9-24/h1-3,6-7,10H,4-5,8-9H2,(H2,21,22,23,25).
What are the key properties of N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide?
N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide has a molecular weight of 342.35 g/mol, XLogP of 4.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)pyrrolidine-1-carboxamide is sourced from PubChem (CID 67367298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).