C21H17Cl3N8O6 — CID 67367317
2-chloro-4-methyl-N-(1,2,4-triazol-4-yl)benzamide;2,3-dichloro-N-(1,2,4-triazol-4-yl)benzamide;oxalic acid (PubChem CID 67367317) has the molecular formula C21H17Cl3N8O6 and a molecular weight of 583.78 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-(1,2,4-triazol-4-yl)benzamide;2,3-dichloro-N-(1,2,4-triazol-4-yl)benzamide;oxalic acid.
| Compound Name | 2-chloro-4-methyl-N-(1,2,4-triazol-4-yl)benzamide;2,3-dichloro-N-(1,2,4-triazol-4-yl)benzamide;oxalic acid |
|---|---|
| PubChem CID | 67367317 |
| Molecular Formula | C21H17Cl3N8O6 |
| Molecular Weight | 583.78 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | 2-chloro-4-methyl-N-(1,2,4-triazol-4-yl)benzamide;2,3-dichloro-N-(1,2,4-triazol-4-yl)benzamide;oxalic acid |
| SMILES | Cc1ccc(C(=O)Nn2cnnc2)c(Cl)c1.O=C(Nn1cnnc1)c1cccc(Cl)c1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H9ClN4O.C9H6Cl2N4O.C2H2O4/c1-7-2-3-8(9(11)4-7)10(16)14-15-5-12-13-6-15;10-7-3-1-2-6(8(7)11)9(16)14-15-4-12-13-5-15;3-1(4)2(5)6/h2-6H,1H3,(H,14,16);1-5H,(H,14,16);(H,3,4)(H,5,6) |
| InChIKey | PIEDDKWHUVGCGV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 194.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.78 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|