About (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate
(6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 6736749) has the molecular formula C19H26F3N3O4
and a molecular weight of 417.43 g/mol. Its IUPAC name is (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate |
| PubChem CID | 6736749 |
| Molecular Formula | C19H26F3N3O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)CCCCCOC(=O)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C19H26F3N3O4/c1-2-28-17(26)6-4-3-5-13-29-18(27)25-11-9-24(10-12-25)16-8-7-15(14-23-16)19(20,21)22/h7-8,14H,2-6,9-13H2,1H3 |
| InChIKey | JXPHBKQCZCJYCH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate?
The IUPAC name of (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate (CID 6736749) is (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate.
What is the SMILES notation for (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate?
The canonical SMILES for (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate is CCOC(=O)CCCCCOC(=O)N1CCN(c2ccc(C(F)(F)F)cn2)CC1.
What is the InChIKey of (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate?
The InChIKey is JXPHBKQCZCJYCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26F3N3O4/c1-2-28-17(26)6-4-3-5-13-29-18(27)25-11-9-24(10-12-25)16-8-7-15(14-23-16)19(20,21)22/h7-8,14H,2-6,9-13H2,1H3.
What are the key properties of (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate?
(6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate has a molecular weight of 417.43 g/mol, XLogP of 3.48, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethoxy-6-oxohexyl) 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate is sourced from PubChem (CID 6736749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).