About methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate
methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate (PubChem CID 67367688) has the molecular formula C33H39N3O4
and a molecular weight of 541.69 g/mol. Its IUPAC name is methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate.
Molecular Properties
| Compound Name | methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate |
| PubChem CID | 67367688 |
| Molecular Formula | C33H39N3O4 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCN(CCCCCC(=O)OC)c1ccc2c(c1)nc(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C33H39N3O4/c1-39-31(37)19-11-5-13-23-35(24-14-6-12-20-32(38)40-2)28-21-22-30-29(25-28)34-33(26-15-7-3-8-16-26)36(30)27-17-9-4-10-18-27/h3-4,7-10,15-18,21-22,25H,5-6,11-14,19-20,23-24H2,1-2H3 |
| InChIKey | IPNRGBILMDMUJH-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate?
The IUPAC name of methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate (CID 67367688) is methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate.
What is the SMILES notation for methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate?
The canonical SMILES for methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate is COC(=O)CCCCCN(CCCCCC(=O)OC)c1ccc2c(c1)nc(-c1ccccc1)n2-c1ccccc1.
What is the InChIKey of methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate?
The InChIKey is IPNRGBILMDMUJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H39N3O4/c1-39-31(37)19-11-5-13-23-35(24-14-6-12-20-32(38)40-2)28-21-22-30-29(25-28)34-33(26-15-7-3-8-16-26)36(30)27-17-9-4-10-18-27/h3-4,7-10,15-18,21-22,25H,5-6,11-14,19-20,23-24H2,1-2H3.
What are the key properties of methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate?
methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate has a molecular weight of 541.69 g/mol, XLogP of 6.97, 15 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(1,2-diphenylbenzimidazol-5-yl)-(6-methoxy-6-oxohexyl)amino]hexanoate is sourced from PubChem (CID 67367688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).