About 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one
3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one (PubChem CID 67368141) has the molecular formula C19H32O2
and a molecular weight of 292.46 g/mol. Its IUPAC name is 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one.
Molecular Properties
| Compound Name | 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one |
| PubChem CID | 67368141 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one |
| SMILES | CCCCC(CC)CC(=O)C1(COC)C(C)=CCC=C1C |
| InChI | InChI=1S/C19H32O2/c1-6-8-12-17(7-2)13-18(20)19(14-21-5)15(3)10-9-11-16(19)4/h10-11,17H,6-9,12-14H2,1-5H3 |
| InChIKey | UYVRZRSCAOSMAN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one?
The IUPAC name of 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one (CID 67368141) is 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one.
What is the SMILES notation for 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one?
The canonical SMILES for 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one is CCCCC(CC)CC(=O)C1(COC)C(C)=CCC=C1C.
What is the InChIKey of 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one?
The InChIKey is UYVRZRSCAOSMAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O2/c1-6-8-12-17(7-2)13-18(20)19(14-21-5)15(3)10-9-11-16(19)4/h10-11,17H,6-9,12-14H2,1-5H3.
What are the key properties of 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one?
3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one has a molecular weight of 292.46 g/mol, XLogP of 5.09, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-[1-(methoxymethyl)-2,6-dimethylcyclohexa-2,5-dien-1-yl]heptan-1-one is sourced from PubChem (CID 67368141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).