C15H24O2 — CID 67369075
1-[1-(methoxymethyl)-2-methylcyclohexa-2,5-dien-1-yl]hexan-1-one (PubChem CID 67369075) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 1-[1-(methoxymethyl)-2-methylcyclohexa-2,5-dien-1-yl]hexan-1-one.
| Compound Name | 1-[1-(methoxymethyl)-2-methylcyclohexa-2,5-dien-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 67369075 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1-[1-(methoxymethyl)-2-methylcyclohexa-2,5-dien-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)C1(COC)C=CCC=C1C |
| InChI | InChI=1S/C15H24O2/c1-4-5-6-10-14(16)15(12-17-3)11-8-7-9-13(15)2/h8-9,11H,4-7,10,12H2,1-3H3 |
| InChIKey | PAIDKDANIWXQLP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|