About 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine
2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine (PubChem CID 67369266) has the molecular formula C21H12Br2ClN3
and a molecular weight of 501.61 g/mol. Its IUPAC name is 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine |
| PubChem CID | 67369266 |
| Molecular Formula | C21H12Br2ClN3 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 498.91 |
| IUPAC Name | 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine |
| SMILES | Clc1cc(-c2ccccc2)cc(-c2ncnc(-c3cc(Br)cc(Br)c3)n2)c1 |
| InChI | InChI=1S/C21H12Br2ClN3/c22-17-7-16(8-18(23)11-17)21-26-12-25-20(27-21)15-6-14(9-19(24)10-15)13-4-2-1-3-5-13/h1-12H |
| InChIKey | UBEGHGMOXKADJE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine?
The IUPAC name of 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine (CID 67369266) is 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine.
What is the SMILES notation for 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine?
The canonical SMILES for 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine is Clc1cc(-c2ccccc2)cc(-c2ncnc(-c3cc(Br)cc(Br)c3)n2)c1.
What is the InChIKey of 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine?
The InChIKey is UBEGHGMOXKADJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12Br2ClN3/c22-17-7-16(8-18(23)11-17)21-26-12-25-20(27-21)15-6-14(9-19(24)10-15)13-4-2-1-3-5-13/h1-12H.
What are the key properties of 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine?
2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine has a molecular weight of 501.61 g/mol, XLogP of 7.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-5-phenylphenyl)-4-(3,5-dibromophenyl)-1,3,5-triazine is sourced from PubChem (CID 67369266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).