C34H39F3N6O2 — CID 67369894
(E)-N-[[(3S,5S)-3-[1-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 67369894) has the molecular formula C34H39F3N6O2 and a molecular weight of 620.72 g/mol. Its IUPAC name is (E)-N-[[(3S,5S)-3-[1-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[[(3S,5S)-3-[1-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67369894 |
| Molecular Formula | C34H39F3N6O2 |
| Molecular Weight | 620.72 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | (E)-N-[[(3S,5S)-3-[1-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCC(N=C(N)N)[C@@H]1N[C@H](CNC(=O)/C=C/c2ccccc2C(F)(F)F)CCN(CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C34H39F3N6O2/c1-2-29(42-33(38)39)31-32(45)43(22-27(23-11-5-3-6-12-23)24-13-7-4-8-14-24)20-19-26(41-31)21-40-30(44)18-17-25-15-9-10-16-28(25)34(35,36)37/h3-18,26-27,29,31,41H,2,19-22H2,1H3,(H,40,44)(H4,38,39,42)/b18-17+/t26-,29?,31-/m0/s1 |
| InChIKey | BSXXKQFYYKNDHZ-OXWYFXIPSA-N |
| XLogP | 4.28 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.72 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|