C10H8Cl2N2O2S2 — CID 6737013
4,5-dichloro-N-(pyridin-3-ylmethyl)thiophene-2-sulfonamide (PubChem CID 6737013) has the molecular formula C10H8Cl2N2O2S2 and a molecular weight of 323.23 g/mol. Its IUPAC name is 4,5-dichloro-N-(pyridin-3-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 4,5-dichloro-N-(pyridin-3-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 6737013 |
| Molecular Formula | C10H8Cl2N2O2S2 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 321.94 |
| IUPAC Name | 4,5-dichloro-N-(pyridin-3-ylmethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1cccnc1)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C10H8Cl2N2O2S2/c11-8-4-9(17-10(8)12)18(15,16)14-6-7-2-1-3-13-5-7/h1-5,14H,6H2 |
| InChIKey | VOBJCVNLUVRVHG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |