C13H20O2 — CID 67370360
1-(cyclopenta-2,4-dien-1-ylmethoxy)heptan-2-one (PubChem CID 67370360) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(cyclopenta-2,4-dien-1-ylmethoxy)heptan-2-one.
| Compound Name | 1-(cyclopenta-2,4-dien-1-ylmethoxy)heptan-2-one |
|---|---|
| PubChem CID | 67370360 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1-(cyclopenta-2,4-dien-1-ylmethoxy)heptan-2-one |
| SMILES | CCCCCC(=O)COCC1C=CC=C1 |
| InChI | InChI=1S/C13H20O2/c1-2-3-4-9-13(14)11-15-10-12-7-5-6-8-12/h5-8,12H,2-4,9-11H2,1H3 |
| InChIKey | BTNPVYFANWNPMP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|