About N-(3-acetylphenyl)-2,2,2-trifluoroacetamide
N-(3-acetylphenyl)-2,2,2-trifluoroacetamide (PubChem CID 673706) has the molecular formula C10H8F3NO2
and a molecular weight of 231.17 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-(3-acetylphenyl)-2,2,2-trifluoroacetamide |
| PubChem CID | 673706 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | N-(3-acetylphenyl)-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F3NO2/c1-6(15)7-3-2-4-8(5-7)14-9(16)10(11,12)13/h2-5H,1H3,(H,14,16) |
| InChIKey | QJIHIZOVLAWHFM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-acetylphenyl)-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-acetylphenyl)-2,2,2-trifluoroacetamide?
The IUPAC name of N-(3-acetylphenyl)-2,2,2-trifluoroacetamide (CID 673706) is N-(3-acetylphenyl)-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-(3-acetylphenyl)-2,2,2-trifluoroacetamide?
The canonical SMILES for N-(3-acetylphenyl)-2,2,2-trifluoroacetamide is CC(=O)c1cccc(NC(=O)C(F)(F)F)c1.
What is the InChIKey of N-(3-acetylphenyl)-2,2,2-trifluoroacetamide?
The InChIKey is QJIHIZOVLAWHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NO2/c1-6(15)7-3-2-4-8(5-7)14-9(16)10(11,12)13/h2-5H,1H3,(H,14,16).
What are the key properties of N-(3-acetylphenyl)-2,2,2-trifluoroacetamide?
N-(3-acetylphenyl)-2,2,2-trifluoroacetamide has a molecular weight of 231.17 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-acetylphenyl)-2,2,2-trifluoroacetamide is sourced from PubChem (CID 673706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).