C19H24ClN5O5 — CID 67370937
2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)-3-(3,4,5-trimethoxyphenyl)guanidine;hydrochloride (PubChem CID 67370937) has the molecular formula C19H24ClN5O5 and a molecular weight of 437.88 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)-3-(3,4,5-trimethoxyphenyl)guanidine;hydrochloride.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)-3-(3,4,5-trimethoxyphenyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 67370937 |
| Molecular Formula | C19H24ClN5O5 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)-3-(3,4,5-trimethoxyphenyl)guanidine;hydrochloride |
| SMILES | COc1cc(N/C(N=C(N)N)=N\Cc2ccc3c(c2)OCO3)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C19H23N5O5.ClH/c1-25-15-7-12(8-16(26-2)17(15)27-3)23-19(24-18(20)21)22-9-11-4-5-13-14(6-11)29-10-28-13;/h4-8H,9-10H2,1-3H3,(H5,20,21,22,23,24);1H |
| InChIKey | XQZCABVXEKSDMX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|