C14H12F3NO3 — CID 67371222
(1R,6S)-1-methyl-6-(3,4,5-trifluorophenyl)-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3,4-dione (PubChem CID 67371222) has the molecular formula C14H12F3NO3 and a molecular weight of 299.25 g/mol. Its IUPAC name is (1R,6S)-1-methyl-6-(3,4,5-trifluorophenyl)-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3,4-dione.
| Compound Name | (1R,6S)-1-methyl-6-(3,4,5-trifluorophenyl)-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3,4-dione |
|---|---|
| PubChem CID | 67371222 |
| Molecular Formula | C14H12F3NO3 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (1R,6S)-1-methyl-6-(3,4,5-trifluorophenyl)-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3,4-dione |
| SMILES | C[C@H]1OC(=O)C(=O)N2C1CC[C@H]2c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H12F3NO3/c1-6-10-2-3-11(18(10)13(19)14(20)21-6)7-4-8(15)12(17)9(16)5-7/h4-6,10-11H,2-3H2,1H3/t6-,10?,11+/m1/s1 |
| InChIKey | SRCFPLNYKQWVAP-WIPMIZNYSA-N |
| XLogP | 2.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|