C15H22Cl3N7O — CID 67371252
4-(piperidin-4-ylamino)-6-(pyrazin-2-ylamino)pyridine-3-carboxamide;trihydrochloride (PubChem CID 67371252) has the molecular formula C15H22Cl3N7O and a molecular weight of 422.75 g/mol. Its IUPAC name is 4-(piperidin-4-ylamino)-6-(pyrazin-2-ylamino)pyridine-3-carboxamide;trihydrochloride.
| Compound Name | 4-(piperidin-4-ylamino)-6-(pyrazin-2-ylamino)pyridine-3-carboxamide;trihydrochloride |
|---|---|
| PubChem CID | 67371252 |
| Molecular Formula | C15H22Cl3N7O |
| Molecular Weight | 422.75 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 4-(piperidin-4-ylamino)-6-(pyrazin-2-ylamino)pyridine-3-carboxamide;trihydrochloride |
| SMILES | Cl.Cl.Cl.NC(=O)c1cnc(Nc2cnccn2)cc1NC1CCNCC1 |
| InChI | InChI=1S/C15H19N7O.3ClH/c16-15(23)11-8-20-13(22-14-9-18-5-6-19-14)7-12(11)21-10-1-3-17-4-2-10;;;/h5-10,17H,1-4H2,(H2,16,23)(H2,19,20,21,22);3*1H |
| InChIKey | ACJVRNSUINEJKS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.75 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |