About 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one
1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one (PubChem CID 67371590) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 67371590 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1c[nH]c2ncc(N)nc12 |
| InChI | InChI=1S/C11H14N4O/c1-11(2,3)9(16)6-4-13-10-8(6)15-7(12)5-14-10/h4-5H,1-3H3,(H2,12,15)(H,13,14) |
| InChIKey | WHWOCBBBKLLVSE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one (CID 67371590) is 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one is CC(C)(C)C(=O)c1c[nH]c2ncc(N)nc12.
What is the InChIKey of 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one?
The InChIKey is WHWOCBBBKLLVSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O/c1-11(2,3)9(16)6-4-13-10-8(6)15-7(12)5-14-10/h4-5H,1-3H3,(H2,12,15)(H,13,14).
What are the key properties of 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one?
1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one has a molecular weight of 218.26 g/mol, XLogP of 1.77, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-5H-pyrrolo[2,3-b]pyrazin-7-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 67371590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).