About [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate
[2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate (PubChem CID 67371941) has the molecular formula C17H18N4O4S
and a molecular weight of 374.42 g/mol. Its IUPAC name is [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate |
| PubChem CID | 67371941 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)Oc1c[nH]c2ncc(-c3cccc(S(C)(=O)=O)c3)nc12 |
| InChI | InChI=1S/C17H18N4O4S/c1-10(2)20-17(22)25-14-9-19-16-15(14)21-13(8-18-16)11-5-4-6-12(7-11)26(3,23)24/h4-10H,1-3H3,(H,18,19)(H,20,22) |
| InChIKey | PAYJDRJWVZQKIL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate?
The IUPAC name of [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate (CID 67371941) is [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate.
What is the SMILES notation for [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate?
The canonical SMILES for [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate is CC(C)NC(=O)Oc1c[nH]c2ncc(-c3cccc(S(C)(=O)=O)c3)nc12.
What is the InChIKey of [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate?
The InChIKey is PAYJDRJWVZQKIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O4S/c1-10(2)20-17(22)25-14-9-19-16-15(14)21-13(8-18-16)11-5-4-6-12(7-11)26(3,23)24/h4-10H,1-3H3,(H,18,19)(H,20,22).
What are the key properties of [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate?
[2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate has a molecular weight of 374.42 g/mol, XLogP of 2.53, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-methylsulfonylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate is sourced from PubChem (CID 67371941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).