C6H11F2NO — CID 67371998
(4,4-difluoropiperidin-3-yl)methanol (PubChem CID 67371998) has the molecular formula C6H11F2NO and a molecular weight of 151.16 g/mol. Its IUPAC name is (4,4-difluoropiperidin-3-yl)methanol.
| Compound Name | (4,4-difluoropiperidin-3-yl)methanol |
|---|---|
| PubChem CID | 67371998 |
| Molecular Formula | C6H11F2NO |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | (4,4-difluoropiperidin-3-yl)methanol |
| SMILES | OCC1CNCCC1(F)F |
| InChI | InChI=1S/C6H11F2NO/c7-6(8)1-2-9-3-5(6)4-10/h5,9-10H,1-4H2 |
| InChIKey | XTGWMTQKEVTLQD-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |