About 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one
1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one (PubChem CID 67372235) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one |
| PubChem CID | 67372235 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one |
| SMILES | CCC(=O)C1(COC)C=CCC=C1 |
| InChI | InChI=1S/C11H16O2/c1-3-10(12)11(9-13-2)7-5-4-6-8-11/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | YGYHEPBDLBEYSX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one?
The IUPAC name of 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one (CID 67372235) is 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one.
What is the SMILES notation for 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one?
The canonical SMILES for 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one is CCC(=O)C1(COC)C=CCC=C1.
What is the InChIKey of 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one?
The InChIKey is YGYHEPBDLBEYSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-3-10(12)11(9-13-2)7-5-4-6-8-11/h5-8H,3-4,9H2,1-2H3.
What are the key properties of 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one?
1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one has a molecular weight of 180.25 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]propan-1-one is sourced from PubChem (CID 67372235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).