About (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate
(2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate (PubChem CID 6737257) has the molecular formula C20H18F5NO3
and a molecular weight of 415.36 g/mol. Its IUPAC name is (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
| PubChem CID | 6737257 |
| Molecular Formula | C20H18F5NO3 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccc(F)cc1F)N1CCC(O)(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H18F5NO3/c21-16-5-4-13(17(22)11-16)12-29-18(27)26-8-6-19(28,7-9-26)14-2-1-3-15(10-14)20(23,24)25/h1-5,10-11,28H,6-9,12H2 |
| InChIKey | WDJORLIYOSBZLN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate?
The IUPAC name of (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate (CID 6737257) is (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate.
What is the SMILES notation for (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate?
The canonical SMILES for (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate is O=C(OCc1ccc(F)cc1F)N1CCC(O)(c2cccc(C(F)(F)F)c2)CC1.
What is the InChIKey of (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate?
The InChIKey is WDJORLIYOSBZLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F5NO3/c21-16-5-4-13(17(22)11-16)12-29-18(27)26-8-6-19(28,7-9-26)14-2-1-3-15(10-14)20(23,24)25/h1-5,10-11,28H,6-9,12H2.
What are the key properties of (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate?
(2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate has a molecular weight of 415.36 g/mol, XLogP of 4.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-difluorophenyl)methyl 4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate is sourced from PubChem (CID 6737257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).