About oxo-bis(1,3-thiazol-2-yloxy)phosphanium
oxo-bis(1,3-thiazol-2-yloxy)phosphanium (PubChem CID 67372593) has the molecular formula C6H4N2O3PS2+
and a molecular weight of 247.22 g/mol. Its IUPAC name is oxo-bis(1,3-thiazol-2-yloxy)phosphanium.
Molecular Properties
| Compound Name | oxo-bis(1,3-thiazol-2-yloxy)phosphanium |
| PubChem CID | 67372593 |
| Molecular Formula | C6H4N2O3PS2+ |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 246.94 |
| IUPAC Name | oxo-bis(1,3-thiazol-2-yloxy)phosphanium |
| SMILES | O=[P+](Oc1nccs1)Oc1nccs1 |
| InChI | InChI=1S/C6H4N2O3PS2/c9-12(10-5-7-1-3-13-5)11-6-8-2-4-14-6/h1-4H/q+1 |
| InChIKey | PWEQMOIQHXYMKU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxo-bis(1,3-thiazol-2-yloxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-bis(1,3-thiazol-2-yloxy)phosphanium?
The IUPAC name of oxo-bis(1,3-thiazol-2-yloxy)phosphanium (CID 67372593) is oxo-bis(1,3-thiazol-2-yloxy)phosphanium.
What is the SMILES notation for oxo-bis(1,3-thiazol-2-yloxy)phosphanium?
The canonical SMILES for oxo-bis(1,3-thiazol-2-yloxy)phosphanium is O=[P+](Oc1nccs1)Oc1nccs1.
What is the InChIKey of oxo-bis(1,3-thiazol-2-yloxy)phosphanium?
The InChIKey is PWEQMOIQHXYMKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O3PS2/c9-12(10-5-7-1-3-13-5)11-6-8-2-4-14-6/h1-4H/q+1.
What are the key properties of oxo-bis(1,3-thiazol-2-yloxy)phosphanium?
oxo-bis(1,3-thiazol-2-yloxy)phosphanium has a molecular weight of 247.22 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-bis(1,3-thiazol-2-yloxy)phosphanium is sourced from PubChem (CID 67372593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).