C37H44N6O2 — CID 67372941
N-[(1S)-1-[(3S,5S)-3-[1-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]-2-naphthalen-2-ylethyl]acetamide (PubChem CID 67372941) has the molecular formula C37H44N6O2 and a molecular weight of 604.80 g/mol. Its IUPAC name is N-[(1S)-1-[(3S,5S)-3-[1-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]-2-naphthalen-2-ylethyl]acetamide.
| Compound Name | N-[(1S)-1-[(3S,5S)-3-[1-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]-2-naphthalen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 67372941 |
| Molecular Formula | C37H44N6O2 |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.35 |
| IUPAC Name | N-[(1S)-1-[(3S,5S)-3-[1-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]-2-naphthalen-2-ylethyl]acetamide |
| SMILES | CCC(N=C(N)N)[C@@H]1N[C@H]([C@H](Cc2ccc3ccccc3c2)NC(C)=O)CCN(CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C37H44N6O2/c1-3-32(42-37(38)39)35-36(45)43(24-31(28-13-6-4-7-14-28)29-15-8-5-9-16-29)21-20-33(41-35)34(40-25(2)44)23-26-18-19-27-12-10-11-17-30(27)22-26/h4-19,22,31-35,41H,3,20-21,23-24H2,1-2H3,(H,40,44)(H4,38,39,42)/t32?,33-,34-,35-/m0/s1 |
| InChIKey | PWVWRKZBHCJIPY-RHINSWJKSA-N |
| XLogP | 4.33 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|