C17H23NO5 — CID 67373012
tert-butyl (5S)-3-oxo-5-(phenylmethoxymethyl)morpholine-4-carboxylate (PubChem CID 67373012) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is tert-butyl (5S)-3-oxo-5-(phenylmethoxymethyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl (5S)-3-oxo-5-(phenylmethoxymethyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 67373012 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | tert-butyl (5S)-3-oxo-5-(phenylmethoxymethyl)morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)COC[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C17H23NO5/c1-17(2,3)23-16(20)18-14(11-22-12-15(18)19)10-21-9-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | TYOCOCXOOARNTM-AWEZNQCLSA-N |
| XLogP | 2.37 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |