About imidazo[4,5-e]thiadiazine
imidazo[4,5-e]thiadiazine (PubChem CID 67373119) has the molecular formula C4H2N4S
and a molecular weight of 138.16 g/mol. Its IUPAC name is imidazo[4,5-e]thiadiazine.
Molecular Properties
| Compound Name | imidazo[4,5-e]thiadiazine |
| PubChem CID | 67373119 |
| Molecular Formula | C4H2N4S |
| Molecular Weight | 138.16 g/mol |
| Exact Mass | 138.00 |
| IUPAC Name | imidazo[4,5-e]thiadiazine |
| SMILES | c1nc2cnnsc-2n1 |
| InChI | InChI=1S/C4H2N4S/c1-3-4(6-2-5-3)9-8-7-1/h1-2H |
| InChIKey | WMDZACXKPQRXLU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.16 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze imidazo[4,5-e]thiadiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[4,5-e]thiadiazine?
The IUPAC name of imidazo[4,5-e]thiadiazine (CID 67373119) is imidazo[4,5-e]thiadiazine.
What is the SMILES notation for imidazo[4,5-e]thiadiazine?
The canonical SMILES for imidazo[4,5-e]thiadiazine is c1nc2cnnsc-2n1.
What is the InChIKey of imidazo[4,5-e]thiadiazine?
The InChIKey is WMDZACXKPQRXLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N4S/c1-3-4(6-2-5-3)9-8-7-1/h1-2H.
What are the key properties of imidazo[4,5-e]thiadiazine?
imidazo[4,5-e]thiadiazine has a molecular weight of 138.16 g/mol, XLogP of 0.43, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[4,5-e]thiadiazine is sourced from PubChem (CID 67373119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).