C26H22F3NO4 — CID 67373263
9H-fluoren-9-ylmethyl (3S,5R)-3-(hydroxymethyl)-5-(3,4,5-trifluorophenyl)morpholine-4-carboxylate (PubChem CID 67373263) has the molecular formula C26H22F3NO4 and a molecular weight of 469.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (3S,5R)-3-(hydroxymethyl)-5-(3,4,5-trifluorophenyl)morpholine-4-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (3S,5R)-3-(hydroxymethyl)-5-(3,4,5-trifluorophenyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 67373263 |
| Molecular Formula | C26H22F3NO4 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (3S,5R)-3-(hydroxymethyl)-5-(3,4,5-trifluorophenyl)morpholine-4-carboxylate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1[C@@H](CO)COC[C@H]1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C26H22F3NO4/c27-22-9-15(10-23(28)25(22)29)24-14-33-12-16(11-31)30(24)26(32)34-13-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-10,16,21,24,31H,11-14H2/t16-,24-/m0/s1 |
| InChIKey | BPOJMBIKVXSUGX-FYSMJZIKSA-N |
| XLogP | 4.79 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|