About ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate
ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 67373437) has the molecular formula C18H23F2NO5
and a molecular weight of 371.38 g/mol. Its IUPAC name is ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
Molecular Properties
| Compound Name | ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| PubChem CID | 67373437 |
| Molecular Formula | C18H23F2NO5 |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | CCOC(=O)[C@@H](CCC(=O)c1ccc(F)c(F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23F2NO5/c1-5-25-16(23)14(21-17(24)26-18(2,3)4)8-9-15(22)11-6-7-12(19)13(20)10-11/h6-7,10,14H,5,8-9H2,1-4H3,(H,21,24)/t14-/m1/s1 |
| InChIKey | BZRNCJZRJAQVOL-CQSZACIVSA-N |
| XLogP | 3.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate?
The IUPAC name of ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (CID 67373437) is ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
What is the SMILES notation for ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate?
The canonical SMILES for ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate is CCOC(=O)[C@@H](CCC(=O)c1ccc(F)c(F)c1)NC(=O)OC(C)(C)C.
What is the InChIKey of ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate?
The InChIKey is BZRNCJZRJAQVOL-CQSZACIVSA-N. The full InChI is InChI=1S/C18H23F2NO5/c1-5-25-16(23)14(21-17(24)26-18(2,3)4)8-9-15(22)11-6-7-12(19)13(20)10-11/h6-7,10,14H,5,8-9H2,1-4H3,(H,21,24)/t14-/m1/s1.
What are the key properties of ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate?
ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate has a molecular weight of 371.38 g/mol, XLogP of 3.38, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate is sourced from PubChem (CID 67373437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).