About 3-methyl-1,2-dihydroindol-3-ol
3-methyl-1,2-dihydroindol-3-ol (PubChem CID 67373673) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-methyl-1,2-dihydroindol-3-ol.
Molecular Properties
| Compound Name | 3-methyl-1,2-dihydroindol-3-ol |
| PubChem CID | 67373673 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3-methyl-1,2-dihydroindol-3-ol |
| SMILES | CC1(O)CNc2ccccc21 |
| InChI | InChI=1S/C9H11NO/c1-9(11)6-10-8-5-3-2-4-7(8)9/h2-5,10-11H,6H2,1H3 |
| InChIKey | BDLKFNQHXGFODU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-1,2-dihydroindol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,2-dihydroindol-3-ol?
The IUPAC name of 3-methyl-1,2-dihydroindol-3-ol (CID 67373673) is 3-methyl-1,2-dihydroindol-3-ol.
What is the SMILES notation for 3-methyl-1,2-dihydroindol-3-ol?
The canonical SMILES for 3-methyl-1,2-dihydroindol-3-ol is CC1(O)CNc2ccccc21.
What is the InChIKey of 3-methyl-1,2-dihydroindol-3-ol?
The InChIKey is BDLKFNQHXGFODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-9(11)6-10-8-5-3-2-4-7(8)9/h2-5,10-11H,6H2,1H3.
What are the key properties of 3-methyl-1,2-dihydroindol-3-ol?
3-methyl-1,2-dihydroindol-3-ol has a molecular weight of 149.19 g/mol, XLogP of 1.32, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,2-dihydroindol-3-ol is sourced from PubChem (CID 67373673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).