C14H13F2NO3 — CID 67374075
(1R,8aS)-6-(3,4-difluorophenyl)-1-methyl-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3,4-dione (PubChem CID 67374075) has the molecular formula C14H13F2NO3 and a molecular weight of 281.26 g/mol. Its IUPAC name is (1R,8aS)-6-(3,4-difluorophenyl)-1-methyl-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3,4-dione.
| Compound Name | (1R,8aS)-6-(3,4-difluorophenyl)-1-methyl-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3,4-dione |
|---|---|
| PubChem CID | 67374075 |
| Molecular Formula | C14H13F2NO3 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (1R,8aS)-6-(3,4-difluorophenyl)-1-methyl-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3,4-dione |
| SMILES | C[C@H]1OC(=O)C(=O)N2C(c3ccc(F)c(F)c3)CC[C@@H]12 |
| InChI | InChI=1S/C14H13F2NO3/c1-7-11-4-5-12(17(11)13(18)14(19)20-7)8-2-3-9(15)10(16)6-8/h2-3,6-7,11-12H,4-5H2,1H3/t7-,11+,12?/m1/s1 |
| InChIKey | FLNOKRATFLDTJN-VDJVUWEHSA-N |
| XLogP | 1.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|