About [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate
[4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 67374542) has the molecular formula C14H15F5O4
and a molecular weight of 342.26 g/mol. Its IUPAC name is [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
Molecular Properties
| Compound Name | [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| PubChem CID | 67374542 |
| Molecular Formula | C14H15F5O4 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC1C(OC(=O)C2CC3C=CC2C3)OC(O)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C14H15F5O4/c1-6-11(23-13(21,12(6,15)16)14(17,18)19)22-10(20)9-5-7-2-3-8(9)4-7/h2-3,6-9,11,21H,4-5H2,1H3 |
| InChIKey | PGXWYGVFWNEUSZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 67374542) is [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate is CC1C(OC(=O)C2CC3C=CC2C3)OC(O)(C(F)(F)F)C1(F)F.
What is the InChIKey of [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is PGXWYGVFWNEUSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F5O4/c1-6-11(23-13(21,12(6,15)16)14(17,18)19)22-10(20)9-5-7-2-3-8(9)4-7/h2-3,6-9,11,21H,4-5H2,1H3.
What are the key properties of [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate?
[4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 342.26 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-difluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-2-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 67374542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).