About (2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylic acid 1-t-butyl ester 2-ethyl ester
(2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylic acid 1-t-butyl ester 2-ethyl ester (PubChem CID 67374625) has the molecular formula C18H24FNO4
and a molecular weight of 337.40 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylate.
Analyze (2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylic acid 1-t-butyl ester 2-ethyl ester with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylic acid 1-t-butyl ester 2-ethyl ester?
The IUPAC name of (2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylic acid 1-t-butyl ester 2-ethyl ester (CID 67374625) is 1-O-tert-butyl 2-O-ethyl (2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for (2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylic acid 1-t-butyl ester 2-ethyl ester?
The canonical SMILES for (2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylic acid 1-t-butyl ester 2-ethyl ester is CCOC(=O)[C@H]1CC[C@H](N1C(=O)OC(C)(C)C)C2=CC=C(C=C2)F.
What is the InChIKey of (2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylic acid 1-t-butyl ester 2-ethyl ester?
The InChIKey is UYPMRUCADWRXRD-LSDHHAIUSA-N. The full InChI is InChI=1S/C18H24FNO4/c1-5-23-16(21)15-11-10-14(12-6-8-13(19)9-7-12)20(15)17(22)24-18(2,3)4/h6-9,14-15H,5,10-11H2,1-4H3/t14-,15+/m0/s1.
What are the key properties of (2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylic acid 1-t-butyl ester 2-ethyl ester?
(2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylic acid 1-t-butyl ester 2-ethyl ester has a molecular weight of 337.40 g/mol, XLogP of 3.60, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-5-(4-fluorophenyl)pyrrolidine-1,2-dicarboxylic acid 1-t-butyl ester 2-ethyl ester is sourced from PubChem (CID 67374625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).