About 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid
2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid (PubChem CID 67374721) has the molecular formula C17H21FN2O2
and a molecular weight of 304.37 g/mol. Its IUPAC name is 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid.
Molecular Properties
| Compound Name | 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid |
| PubChem CID | 67374721 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid |
| SMILES | CC(C)(C)C1CC2(C=Nc3ccc(F)cc32)CCN1C(=O)O |
| InChI | InChI=1S/C17H21FN2O2/c1-16(2,3)14-9-17(6-7-20(14)15(21)22)10-19-13-5-4-11(18)8-12(13)17/h4-5,8,10,14H,6-7,9H2,1-3H3,(H,21,22) |
| InChIKey | DQWJXRFXPCVYTL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid?
The IUPAC name of 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid (CID 67374721) is 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid.
What is the SMILES notation for 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid?
The canonical SMILES for 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid is CC(C)(C)C1CC2(C=Nc3ccc(F)cc32)CCN1C(=O)O.
What is the InChIKey of 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid?
The InChIKey is DQWJXRFXPCVYTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FN2O2/c1-16(2,3)14-9-17(6-7-20(14)15(21)22)10-19-13-5-4-11(18)8-12(13)17/h4-5,8,10,14H,6-7,9H2,1-3H3,(H,21,22).
What are the key properties of 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid?
2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid has a molecular weight of 304.37 g/mol, XLogP of 3.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-tert-butyl-5-fluorospiro[indole-3,4'-piperidine]-1'-carboxylic acid is sourced from PubChem (CID 67374721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).